CymitQuimica logo

CAS 116453-90-8

:

1,4-Dipropoxy-2,3-naphthalenedicarbonitrile

Description:
1,4-Dipropoxy-2,3-naphthalenedicarbonitrile is an organic compound characterized by its naphthalene backbone, which is substituted with two propoxy groups and two cyano groups. This compound features a naphthalene structure, which consists of two fused aromatic rings, contributing to its stability and potential for π-π stacking interactions. The presence of the cyano groups (-C≡N) introduces significant polarity and can enhance the compound's reactivity, making it useful in various chemical applications. The propoxy groups (-O-C3H7) provide solubility in organic solvents and can influence the compound's physical properties, such as melting and boiling points. Additionally, the compound may exhibit interesting optical properties due to its conjugated system, making it a candidate for applications in organic electronics or as a dye. Its specific characteristics, such as solubility, melting point, and reactivity, would depend on the molecular interactions and the environment in which it is used. Safety data and handling precautions should be consulted due to the presence of cyano groups, which can be toxic.
Formula:C18H18N2O2
InChI:InChI=1S/C18H18N2O2/c1-3-9-21-17-13-7-5-6-8-14(13)18(22-10-4-2)16(12-20)15(17)11-19/h5-8H,3-4,9-10H2,1-2H3
InChI key:InChIKey=ZVRSLORNZBCISX-UHFFFAOYSA-N
SMILES:O(CCC)C=1C2=C(C(OCCC)=C(C#N)C1C#N)C=CC=C2
Synonyms:
  • 1,4-Dipropoxy-2,3-naphthalenedicarbonitrile
  • 2,3-Naphthalenedicarbonitrile, 1,4-dipropoxy-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.