
CAS 116458-08-3
:1,1,1-Trimethyl-N-(2-methyl-2-propen-1-yl)silanamine
Description:
1,1,1-Trimethyl-N-(2-methyl-2-propen-1-yl)silanamine is an organosilicon compound characterized by the presence of a silicon atom bonded to three methyl groups and an amine functional group. This compound features a vinyl group, which contributes to its reactivity, particularly in polymerization and cross-linking reactions. The presence of the silane moiety enhances its compatibility with various substrates, making it useful in applications such as sealants, adhesives, and coatings. The compound is typically colorless to pale yellow and may have a characteristic odor. Its chemical structure allows for potential applications in the synthesis of silicone-based materials, where it can act as a coupling agent or modifier. Additionally, the presence of the amine group may impart basicity, influencing its reactivity in various chemical processes. Safety data should be consulted for handling and storage, as organosilicon compounds can exhibit varying degrees of toxicity and environmental impact. Overall, this compound exemplifies the versatility of silanes in organic synthesis and materials science.
Formula:C7H17NSi
InChI:InChI=1S/C7H17NSi/c1-7(2)6-8-9(3,4)5/h8H,1,6H2,2-5H3
InChI key:InChIKey=QMHXMPQVHIGLBZ-UHFFFAOYSA-N
SMILES:N([Si](C)(C)C)CC(C)=C
Synonyms:- 1,1,1-Trimethyl-N-(2-methyl-2-propen-1-yl)silanamine
- Silanamine, 1,1,1-trimethyl-N-(2-methyl-2-propenyl)-
- Silanamine, 1,1,1-trimethyl-N-(2-methyl-2-propen-1-yl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Silanamine, 1,1,1-trimethyl-N-(2-methyl-2-propen-1-yl)-
CAS:Formula:C7H17NSiMolecular weight:143.3021
