CAS 116460-89-0
:ETHYL 3-(4-CYANOPHENYL)PROPANOATE
Description:
Ethyl 3-(4-cyanophenyl)propanoate, with the CAS number 116460-89-0, is an organic compound characterized by its ester functional group. It features a propanoate backbone with an ethyl group and a 4-cyanophenyl substituent, which contributes to its unique chemical properties. This compound typically appears as a colorless to pale yellow liquid and is known for its moderate volatility. Ethyl 3-(4-cyanophenyl)propanoate is soluble in organic solvents such as ethanol and ether but has limited solubility in water due to its hydrophobic nature. The presence of the cyano group (–CN) enhances its reactivity, making it a valuable intermediate in organic synthesis, particularly in the production of pharmaceuticals and agrochemicals. Its molecular structure allows for various chemical reactions, including nucleophilic substitutions and condensation reactions. Safety data indicates that, like many organic compounds, it should be handled with care, as it may pose health risks if inhaled or ingested. Proper storage and handling protocols are essential to ensure safety in laboratory and industrial settings.
Formula:C12H13NO2
InChI:InChI=1/C12H13NO2/c1-2-15-12(14)8-7-10-3-5-11(9-13)6-4-10/h3-6H,2,7-8H2,1H3
SMILES:CCOC(=O)CCc1ccc(cc1)C#N
Synonyms:- 3-(4-Cyano-Phenyl)-Propionic Acid Ethyl Ester
- Ethyl-3-(4-cyanophenyl)propionate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
