CAS 116476-55-2

N1,N3-Bis(2,5-dichlorophenyl)-2-phenylpropanediamide

Description:

N1,N3-Bis(2,5-dichlorophenyl)-2-phenylpropanediamide, with the CAS number 116476-55-2, is a synthetic organic compound characterized by its amide functional groups and a complex aromatic structure. This compound features two 2,5-dichlorophenyl groups attached to a central propanediamide backbone, which contributes to its potential biological activity. The presence of chlorine substituents enhances its lipophilicity and may influence its interaction with biological targets. Typically, compounds of this nature are investigated for their pharmacological properties, including potential applications in medicinal chemistry. The molecular structure suggests that it may exhibit significant steric hindrance, which can affect its reactivity and binding affinity. Additionally, the compound's stability, solubility, and melting point are influenced by its molecular interactions and the presence of halogen atoms. As with many synthetic compounds, safety data and handling precautions are essential for laboratory work, given the potential toxicity associated with chlorinated aromatic compounds. Further studies would be necessary to elucidate its specific applications and mechanisms of action in biological systems.

Formula: C₂₁H₁₄Cl₄N₂O₂

InChI: InChI=1S/C21H14Cl4N2O2/c22-13-6-8-15(24)17(10-13)26-20(28)19(12-4-2-1-3-5-12)21(29)27-18-11-14(23)7-9-16(18)25/h1-11,19H,(H,26,28)(H,27,29)

InChI key: InChIKey=ODNCMLCKMYRBOH-UHFFFAOYSA-N

SMILES: C(C(NC1=C(Cl)C=CC(Cl)=C1)=O)(C(NC2=C(Cl)C=CC(Cl)=C2)=O)C3=CC=CC=C3

Synonyms:

• Propanediamide, N,N′-bis(2,5-dichlorophenyl)-2-phenyl-
• Propanediamide, N1,N3-bis(2,5-dichlorophenyl)-2-phenyl-
• N1,N3-Bis(2,5-dichlorophenyl)-2-phenylpropanediamide

Propanediamide, N1,N3-bis(2,5-dichlorophenyl)-2-phenyl-

CAS: 116476-55-2

Formula: C₂₁H₁₄Cl₄N₂O₂

Molecular weight: 468.1601

Ref: IN-DA000CLM