CAS 116476-70-1
:N,N'-bis(3-methylphenyl)propanediamide
Description:
N,N'-bis(3-methylphenyl)propanediamide, identified by its CAS number 116476-70-1, is an organic compound characterized by its amide functional groups and a propanediamide backbone. This substance features two 3-methylphenyl groups attached to a central propanediamide structure, which contributes to its unique chemical properties. The presence of the methyl groups on the phenyl rings enhances its hydrophobic characteristics and may influence its solubility in organic solvents. Typically, compounds of this nature exhibit moderate to high melting points and can participate in hydrogen bonding due to the amide groups, which can affect their reactivity and interactions with other molecules. Additionally, the steric hindrance introduced by the methyl groups can impact the compound's conformational flexibility and overall stability. N,N'-bis(3-methylphenyl)propanediamide may find applications in various fields, including materials science and pharmaceuticals, due to its potential as a building block in organic synthesis or as a ligand in coordination chemistry.
Formula:C17H18N2O2
InChI:InChI=1/C17H18N2O2/c1-12-5-3-7-14(9-12)18-16(20)11-17(21)19-15-8-4-6-13(2)10-15/h3-10H,11H2,1-2H3,(H,18,20)(H,19,21)
SMILES:Cc1cccc(c1)N=C(CC(=Nc1cccc(C)c1)O)O
Synonyms:- N,N'-Bis(3-methylphenyl)malonamide
- propanediamide, N~1~,N~3~-bis(3-methylphenyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
N,N'-Bis(3-methylphenyl)propanediamide
CAS:Controlled ProductApplications N,N'-Bis(3-methylphenyl)propanediamide is an intermediate in the synthesis of 2,4-Dichloro-7-methylquinoline (D436238). 2,4-Dichloro-7-methylquinoline (cas# 102878-19-3) is a useful research chemical.
Formula:C17H18N2O2Color and Shape:NeatMolecular weight:282.34
