CAS 116477-44-2

N-acetyl-S-(1-cyano-2-hydroxyethyl)cysteine

Description:

N-acetyl-S-(1-cyano-2-hydroxyethyl)cysteine, identified by its CAS number 116477-44-2, is a synthetic derivative of cysteine, an amino acid that plays a crucial role in various biological processes. This compound features a cyano group and a hydroxyethyl moiety, which contribute to its unique chemical properties. It is characterized by its ability to act as a nucleophile due to the thiol group present in cysteine, which can participate in various biochemical reactions, including those involving redox processes. The N-acetyl group enhances its stability and solubility in biological systems. This compound may exhibit antioxidant properties and has potential applications in pharmaceuticals, particularly in the development of drugs targeting oxidative stress-related conditions. Its structure allows for interactions with various biological molecules, making it a subject of interest in medicinal chemistry and biochemistry. However, specific details regarding its reactivity, stability, and biological activity would require further investigation through empirical studies.

Formula: C₈H₁₂N₂O₄S

InChI: InChI=1/C8H12N2O4S/c1-5(12)10-7(8(13)14)4-15-6(2-9)3-11/h6-7,11H,3-4H2,1H3,(H,10,12)(H,13,14)/t6?,7-/m0/s1

SMILES: CC(=N[C@@H](CSC(C#N)CO)C(=O)O)O

Synonyms:

• Chema
• L-Cysteine, N-acetyl-S-(1-cyano-2-hydroxyethyl)-
• N-acetyl-S-(1-cyano-2-hydroxyethyl)-L-cysteine