CAS 116480-63-8

1-(Phenylmethyl)-3-(1,2,3,6-tetrahydro-1-methyl-4-pyridinyl)-1H-indole

Description:

1-(Phenylmethyl)-3-(1,2,3,6-tetrahydro-1-methyl-4-pyridinyl)-1H-indole, with the CAS number 116480-63-8, is a chemical compound that belongs to the class of indole derivatives. This substance features a complex structure that includes an indole core, a phenylmethyl group, and a tetrahydropyridine moiety. The presence of the indole ring suggests potential biological activity, as indoles are known for their occurrence in various natural products and pharmaceuticals. The tetrahydropyridine component may contribute to its pharmacological properties, possibly influencing its interaction with biological targets. The compound is likely to exhibit moderate to high lipophilicity due to the aromatic and aliphatic groups, which can affect its solubility and permeability in biological systems. Additionally, the presence of nitrogen in the pyridine ring may impart basicity, influencing its reactivity and interactions in chemical environments. Overall, this compound's unique structural features suggest potential applications in medicinal chemistry, particularly in the development of therapeutic agents.

Formula: C₂₁H₂₂N₂

InChI: InChI=1S/C21H22N2/c1-22-13-11-18(12-14-22)20-16-23(15-17-7-3-2-4-8-17)21-10-6-5-9-19(20)21/h2-11,16H,12-15H2,1H3

InChI key: InChIKey=JCCNEBIRCTWQEL-UHFFFAOYSA-N

SMILES: C(N1C=C(C=2C1=CC=CC2)C=3CCN(C)CC3)C4=CC=CC=C4

Synonyms:

• 1H-Indole, 1-(phenylmethyl)-3-(1,2,3,6-tetrahydro-1-methyl-4-pyridinyl)-
• 1-(Phenylmethyl)-3-(1,2,3,6-tetrahydro-1-methyl-4-pyridinyl)-1H-indole

1H-Indole, 1-(phenylmethyl)-3-(1,2,3,6-tetrahydro-1-methyl-4-pyridinyl)-

CAS: 116480-63-8

Formula: C₂₁H₂₂N₂

Molecular weight: 302.4128

Ref: IN-DA000CL7