CymitQuimica logo

CAS 116492-99-0

:

4-CYANO-5-(METHYLTHIO)-3-[3-(TRIFLUOROMETHYL)PHENYL]THIOPHENE-2-CARBOXYLIC ACID

Description:
4-Cyano-5-(methylthio)-3-[3-(trifluoromethyl)phenyl]thiophene-2-carboxylic acid is an organic compound characterized by its complex structure, which includes a thiophene ring, a cyano group, and a trifluoromethyl-substituted phenyl group. The presence of the thiophene moiety contributes to its potential applications in organic electronics and materials science due to its conjugated system, which can facilitate charge transport. The cyano group enhances the compound's electron-withdrawing properties, potentially increasing its reactivity and solubility in various solvents. The methylthio group may influence the compound's electronic properties and steric effects, while the trifluoromethyl group is known for imparting lipophilicity and enhancing biological activity. This compound may exhibit interesting photophysical properties, making it a candidate for use in dyes or sensors. Its carboxylic acid functionality can participate in hydrogen bonding and may influence its solubility and reactivity in different chemical environments. Overall, this compound's unique combination of functional groups suggests diverse applications in fields such as organic synthesis, materials science, and medicinal chemistry.
Formula:C14H8F3NO2S2
InChI:InChI=1/C14H8F3NO2S2/c1-21-13-9(6-18)10(11(22-13)12(19)20)7-3-2-4-8(5-7)14(15,16)17/h2-5H,1H3,(H,19,20)
SMILES:CSc1c(C#N)c(c2cccc(c2)C(F)(F)F)c(C(=O)O)s1
Synonyms:
  • 2-Thiophenecarboxylic Acid, 4-Cyano-5-(Methylthio)-3-[3-(Trifluoromethyl)Phenyl]-
  • 4-Cyano-5-(methylsulfanyl)-3-[3-(trifluoromethyl)phenyl]thiophene-2-carboxylic acid
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.