CAS 116493-07-3: 4-cyano-3-(4-methoxyphenyl)-5-(methylthio)thiophene-2-carboxylic acid

Description: 4-Cyano-3-(4-methoxyphenyl)-5-(methylthio)thiophene-2-carboxylic acid is an organic compound characterized by its complex structure, which includes a thiophene ring, a cyano group, a methoxyphenyl substituent, and a methylthio group. This compound features a carboxylic acid functional group, contributing to its acidic properties. The presence of the cyano group enhances its electron-withdrawing characteristics, which can influence its reactivity and solubility in various solvents. The methoxy group typically increases the compound's lipophilicity, while the methylthio group may impart unique electronic properties. This compound is of interest in organic synthesis and materials science, particularly in the development of organic semiconductors and dyes. Its specific interactions and stability can be influenced by factors such as pH, temperature, and the presence of other chemical species. Overall, 4-cyano-3-(4-methoxyphenyl)-5-(methylthio)thiophene-2-carboxylic acid exemplifies the diverse functionalities that can be achieved through careful molecular design in organic chemistry.

Formula: C₁₄H₁₁NO₃S₂

InChI: InChI=1/C14H11NO3S2/c1-18-9-5-3-8(4-6-9)11-10(7-15)14(19-2)20-12(11)13(16)17/h3-6H,1-2H3,(H,16,17)

Synonyms:

• 4-Cyano-3-(4-Methoxyphenyl)-5-(Methylsulfanyl)Thiophene-2-Carboxylic Acid

2-Thiophenecarboxylic acid, 4-cyano-3-(4-methoxyphenyl)-5-(methylthio)-

CAS: 116493-07-3

• Formula: C₁₄H₁₁NO₃S₂
• Molecular weight: 305.3720

4-Cyano-3-(4-methoxyphenyl)-5-(methylthio)thiophene-2-carboxylic acid

CAS: 116493-07-3

• Molecular weight: 305.37g/mol

4-cyano-3-(4-methoxyphenyl)-5-(methylthio)thiophene-2-carboxylic acid

CAS: 116493-07-3

• Molecular weight: 305.3699951171875