CAS 116495-45-5
:(lys4)-sarafotoxin S6C
Description:
Lys4-sarafotoxin S6C is a synthetic analog of sarafotoxin, a peptide derived from the venom of certain snakes, particularly the African mamba. This compound is characterized by its structure, which includes a sequence of amino acids that contribute to its biological activity. It is known for its potent vasoconstrictive properties, primarily acting on the endothelin receptors, which play a crucial role in regulating blood pressure and vascular tone. The modification of the lysine residue at position 4 enhances its stability and receptor affinity compared to its natural counterparts. Due to its specific interactions with endothelin receptors, lys4-sarafotoxin S6C is of interest in pharmacological research, particularly in the context of cardiovascular diseases and potential therapeutic applications. Additionally, its unique properties make it a valuable tool for studying receptor signaling pathways and the physiological effects of endothelin peptides. As with many bioactive peptides, careful handling and consideration of its biological effects are essential in research and potential clinical applications.
Formula:C105H153N27O36S5
InChI:InChI=1/C103H151N27O37S5/c1-10-46(6)80(100(163)123-67(103(166)167)30-50-37-109-54-19-15-14-18-52(50)54)128-99(162)79(45(4)5)127-95(158)66(36-78(144)145)120-85(148)55(20-23-71(105)133)112-90(153)61(31-51-38-108-43-110-51)117-97(160)69(41-170)125-89(152)60(29-49-16-12-11-13-17-49)116-91(154)62(32-72(106)134)118-88(151)59(28-44(2)3)115-96(159)68(40-169)124-86(149)57(22-25-75(138)139)111-84(147)56(21-24-74(136)137)113-94(157)65(35-77(142)143)122-101(164)82(48(8)132)130-87(150)58(26-27-172-9)114-93(156)64(34-76(140)141)121-92(155)63(33-73(107)135)119-98(161)70(42-171)126-102(165)81(47(7)131)129-83(146)53(104)39-168/h11-19,37-38,43-48,53,55-70,79-82,109,131-132,168-171H,10,20-36,39-42,104H2,1-9H3,(H2,105,133)(H2,106,134)(H2,107,135)(H,108,110)(H,111,147)(H,112,153)(H,113,157)(H,114,156)(H,115,159)(H,116,154)(H,117,160)(H,118,151)(H,119,161)(H,120,148)(H,121,155)(H,122,164)(H,123,163)(H,124,149)(H,125,152)(H,126,165)(H,127,158)(H,128,162)(H,129,146)(H,130,150)(H,136,137)(H,138,139)(H,140,141)(H,142,143)(H,144,145)(H,166,167)/t46-,47+,48+,53-,55-,56-,57-,58-,59-,60-,61-,62-,63-,64-,65-,66-,67-,68-,69-,70-,79-,80-,81-,82-/m0/s1
Synonyms:- Sarafotoxin S 6c (reduced)
- Sarafotoxin 6c (reduced)
- Sarafotoxin c (reduced)
- Sarafotoxin 6C, [Lys4]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.