CAS 116496-16-3
:4-Isopropyl-2-methylbenzene-1-sulfonic acid
Description:
4-Isopropyl-2-methylbenzene-1-sulfonic acid, also known as a sulfonic acid derivative, is characterized by its aromatic structure, which includes a benzene ring substituted with both isopropyl and methyl groups, as well as a sulfonic acid functional group (-SO3H). This compound is typically a colorless to pale yellow solid or liquid, depending on its form and purity. It is soluble in water and polar organic solvents, making it useful in various applications, including as a surfactant, in dye manufacturing, and in organic synthesis. The presence of the sulfonic acid group imparts strong acidity, allowing it to act as a proton donor in chemical reactions. Additionally, the branched alkyl substituents contribute to its hydrophobic characteristics, influencing its behavior in mixtures and solutions. Safety data should be consulted for handling, as sulfonic acids can be corrosive and may pose health risks upon exposure. Overall, this compound is significant in both industrial and research contexts due to its unique chemical properties.
Formula:C10H14O3S
InChI:InChI=1/C10H14O3S/c1-7(2)9-4-5-10(8(3)6-9)14(11,12)13/h4-7H,1-3H3,(H,11,12,13)
SMILES:CC(C)c1ccc(c(C)c1)S(=O)(=O)O
Synonyms:- m-Cymene-2-sulfonic acid
- 2-Methyl-4-(1-Methylethyl)Benzenesulfonic Acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.