CAS 1165-14-6
:1,2,3-triphenylbenzene
Description:
1,2,3-Triphenylbenzene, with the CAS number 1165-14-6, is an organic compound characterized by its unique structure, which consists of a benzene ring substituted at the 1, 2, and 3 positions with three phenyl groups. This compound is a polycyclic aromatic hydrocarbon (PAH) and exhibits a high degree of symmetry and stability due to its aromatic nature. It is typically a solid at room temperature and is known for its relatively high melting point. The presence of multiple phenyl groups contributes to its hydrophobic characteristics and can influence its solubility in various organic solvents. 1,2,3-Triphenylbenzene is often studied for its photophysical properties and potential applications in organic electronics and materials science. Additionally, it may exhibit interesting optical behaviors, such as fluorescence, making it a subject of interest in research related to light-emitting devices. However, like many PAHs, it is important to consider its environmental impact and potential toxicity in various applications.
Formula:C24H18
InChI:InChI=1/C24H18/c1-4-11-19(12-5-1)22-17-10-18-23(20-13-6-2-7-14-20)24(22)21-15-8-3-9-16-21/h1-18H
SMILES:c1ccc(cc1)c1cccc(c2ccccc2)c1c1ccccc1
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
