CAS 116505-53-4
:Chlorambucil half mustard
Description:
Chlorambucil half mustard, also known as a derivative of the alkylating agent chlorambucil, is a chemical compound primarily used in the treatment of certain types of cancer, particularly chronic lymphocytic leukemia and lymphoma. It functions by interfering with DNA replication, thereby inhibiting the growth of cancer cells. The compound is characterized by its ability to form covalent bonds with DNA, leading to cross-linking that disrupts cellular division. Chlorambucil half mustard is typically administered in a clinical setting, and its pharmacokinetics involve absorption through the gastrointestinal tract, with metabolism occurring primarily in the liver. The compound exhibits a moderate toxicity profile, necessitating careful monitoring of patients for potential side effects, which may include bone marrow suppression and gastrointestinal disturbances. As with many chemotherapeutic agents, its use is often balanced against the potential for adverse effects, making it essential for healthcare providers to tailor treatment regimens to individual patient needs. Overall, chlorambucil half mustard represents a significant tool in oncological pharmacotherapy.
Formula:C12H16ClNO2
InChI:InChI=1/C12H16ClNO2/c13-8-9-14-11-6-4-10(5-7-11)2-1-3-12(15)16/h4-7,14H,1-3,8-9H2,(H,15,16)
SMILES:C(Cc1ccc(cc1)NCCCl)CC(=O)O
Synonyms:- 4-((2-Chloroethyl)amino)benzenebutanoic acid
- Ccris 1318
- Benzenebutanoic acid, 4-((2-chloroethyl)amino)-
- 4-{4-[(2-Chloroethyl)Amino]Phenyl}Butanoic Acid
- Chlorambucil half-mustard
- Chlorambucil EP Impurity B
- Chlorambucil impurity B
- Chlorambucil Impurity 2 (Chlorambucil EP Impurity B)
- 4-[4-(2-chloroethylamino)phenyl]butanoic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 3 products.
Chlorambucil EP Impurity B
CAS:Formula:C12H16ClNO2Color and Shape:White To Off-White SolidMolecular weight:241.72N-Des-(2-chloroethyl) Chlorambucil
CAS:Controlled ProductApplications N-Des-(2-chloroethyl) Chlorambucil is the half-mustard analog of Chlorambucil (C325050) and exhibits mutagenic activity.
References Ferguson, L.R., et al.: Anti-Cancer Drug Des., 3, 67 (1988)Formula:C12H16ClNO2Color and Shape:Off WhiteMolecular weight:241.714


