CymitQuimica logo

CAS 116508-54-4

:

(S)-METHYL-(2-PHENYL-1-PYRROLIDIN-1-YLMETHYL-ETHYL)-AMINE

Description:
(S)-Methyl-(2-phenyl-1-pyrrolidin-1-ylmethyl-ethyl)-amine, with the CAS number 116508-54-4, is a chiral amine characterized by its complex structure that includes a pyrrolidine ring and a phenyl group. This compound is typically studied in the context of medicinal chemistry and pharmacology due to its potential biological activity. The presence of the pyrrolidine moiety suggests that it may interact with various biological targets, possibly influencing neurotransmitter systems. As a chiral molecule, it exists in two enantiomeric forms, with the (S)-configuration often being associated with specific pharmacological effects. The compound's solubility, stability, and reactivity can vary based on its molecular structure and the functional groups present. Additionally, its synthesis and characterization are of interest in the development of new therapeutic agents. Safety and handling considerations are essential, as with many amines, due to potential toxicity and reactivity. Overall, this compound represents a significant area of research in the development of novel pharmaceuticals.
Formula:C14H22N2
InChI:InChI=1/C14H22N2/c1-15-14(12-16-9-5-6-10-16)11-13-7-3-2-4-8-13/h2-4,7-8,14-15H,5-6,9-12H2,1H3/t14-/m0/s1
SMILES:CN[C@@H](Cc1ccccc1)CN1CCCC1
Synonyms:
  • (2S)-N-Methyl-1-phenyl-3-(pyrrolidin-1-yl)propan-2-amine
  • 1-Pyrrolidineethanamine, N-methyl-α-(phenylmethyl)-, (alphaS)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.