
CAS 116508-55-5
:4,5,6,7-Tetrafluoro-2-(1-methylethyl)-1H-isoindole-1,3(2H)-dione
Description:
4,5,6,7-Tetrafluoro-2-(1-methylethyl)-1H-isoindole-1,3(2H)-dione, with the CAS number 116508-55-5, is a synthetic organic compound characterized by its unique structure that includes a fused isoindole ring system and multiple fluorine substituents. The presence of four fluorine atoms significantly influences its chemical properties, enhancing its stability and lipophilicity, which can affect its reactivity and interaction with biological systems. This compound typically exhibits a solid state at room temperature and may have a relatively high melting point due to the strong intermolecular forces associated with fluorinated compounds. Its functional groups suggest potential applications in pharmaceuticals or agrochemicals, where fluorination can improve metabolic stability and bioactivity. Additionally, the presence of the isopropyl group contributes to its steric bulk, which may influence its binding interactions in biological contexts. Overall, this compound's unique characteristics make it a subject of interest in various fields of chemical research and application.
Formula:C11H7F4NO2
InChI:InChI=1S/C11H7F4NO2/c1-3(2)16-10(17)4-5(11(16)18)7(13)9(15)8(14)6(4)12/h3H,1-2H3
InChI key:InChIKey=HRECWOSIKPDLLL-UHFFFAOYSA-N
SMILES:O=C1C=2C(C(=O)N1C(C)C)=C(F)C(F)=C(F)C2F
Synonyms:- 4,5,6,7-Tetrafluoro-2-(1-methylethyl)-1H-isoindole-1,3(2H)-dione
- 1H-Isoindole-1,3(2H)-dione, 4,5,6,7-tetrafluoro-2-(1-methylethyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
1H-Isoindole-1,3(2H)-dione, 4,5,6,7-tetrafluoro-2-(1-methylethyl)-
CAS:Formula:C11H7F4NO2Molecular weight:261.1724
