CAS 116515-49-2
:5,6,7,7a-Tetrahydro-7a-hydroxy-3H-pyrrolizin-3-one
Description:
5,6,7,7a-Tetrahydro-7a-hydroxy-3H-pyrrolizin-3-one, with the CAS number 116515-49-2, is a heterocyclic organic compound characterized by its pyrrolizinone structure. This compound features a fused bicyclic system, which includes a pyrrolidine ring and a carbonyl group, contributing to its unique chemical properties. The presence of the hydroxy group at the 7a position enhances its reactivity and potential for hydrogen bonding, making it of interest in various chemical reactions and applications. Its molecular structure suggests it may exhibit biological activity, which could be explored in pharmacological contexts. Additionally, the compound's stereochemistry and functional groups may influence its solubility, stability, and interaction with other molecules. While specific applications and biological activities may vary, compounds of this type are often investigated for their potential use in medicinal chemistry and as intermediates in organic synthesis. Further studies would be necessary to fully elucidate its properties and potential applications in various fields.
Formula:C7H9NO2
InChI:InChI=1S/C7H9NO2/c9-6-2-4-7(10)3-1-5-8(6)7/h2,4,10H,1,3,5H2
InChI key:InChIKey=UHWVDQANLORLJQ-UHFFFAOYSA-N
SMILES:OC12N(C(=O)C=C1)CCC2
Synonyms:- 5,6,7,7a-Tetrahydro-7a-hydroxy-3H-pyrrolizin-3-one
- 3H-Pyrrolizin-3-one, 5,6,7,7a-tetrahydro-7a-hydroxy-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
