CymitQuimica logo

CAS 116522-65-7

:

4-(6-Amino-9H-purin-9-yl)-2-butenoic acid

Description:
4-(6-Amino-9H-purin-9-yl)-2-butenoic acid, also known by its CAS number 116522-65-7, is a chemical compound that features a purine base structure, which is a key component of nucleic acids. This substance is characterized by the presence of an amino group and a butenoic acid moiety, contributing to its potential biological activity. It is typically a white to off-white solid, soluble in polar solvents, and may exhibit moderate stability under standard conditions. The compound is of interest in biochemical research, particularly in studies related to nucleic acid metabolism and potential therapeutic applications. Its structural features suggest that it may interact with various biological targets, influencing cellular processes. As with many purine derivatives, it may play a role in cellular signaling or serve as a precursor in the synthesis of other biologically relevant molecules. Proper handling and storage conditions are essential to maintain its integrity and prevent degradation.
Formula:C9H9N5O2
InChI:InChI=1S/C9H9N5O2/c10-8-7-9(12-4-11-8)14(5-13-7)3-1-2-6(15)16/h1-2,4-5H,3H2,(H,15,16)(H2,10,11,12)
InChI key:InChIKey=KYZTVBQYKOVRFU-UHFFFAOYSA-N
SMILES:C(C=CC(O)=O)N1C=2C(N=C1)=C(N)N=CN2
Synonyms:
  • 4-(6-Amino-9H-purin-9-yl)-2-butenoic acid
  • 2-Butenoic acid, 4-(6-amino-9H-purin-9-yl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.