CAS 116529-60-3

2-Bromo-3,5-dinitrobenzoic acid

Description:

2-Bromo-3,5-dinitrobenzoic acid is an aromatic compound characterized by the presence of a bromine atom and two nitro groups attached to a benzoic acid structure. Its molecular formula typically includes carbon, hydrogen, nitrogen, and bromine, reflecting its complex functional groups. The compound is known for its strong acidity due to the carboxylic acid group, which can donate protons in solution. The nitro groups are electron-withdrawing, which enhances the acidity of the carboxylic acid and influences the compound's reactivity. Additionally, the presence of the bromine atom can affect the compound's electrophilic substitution reactions, making it a useful intermediate in organic synthesis. 2-Bromo-3,5-dinitrobenzoic acid is often utilized in various chemical applications, including as a reagent in the synthesis of other organic compounds and in studies related to its biological activity. Its physical properties, such as solubility and melting point, can vary based on the specific conditions and purity of the substance.

Formula: C₇H₃BrN₂O₆

InChI: InChI=1S/C7H3BrN2O6/c8-6-4(7(11)12)1-3(9(13)14)2-5(6)10(15)16/h1-2H,(H,11,12)

InChI key: InChIKey=BBKJKUFARRJPRP-UHFFFAOYSA-N

SMILES: C(O)(=O)C1=C(Br)C(N(=O)=O)=CC(N(=O)=O)=C1

Synonyms:

• Benzoic acid, 2-bromo-3,5-dinitro-
• Wnr Be Cvq Enw
• 2-Bromo-3,5-dinitrobenzoic acid

Benzoic acid, 2-bromo-3,5-dinitro-

CAS: 116529-60-3

Formula: C₇H₃BrN₂O₆

Purity: 98%

Color and Shape: Solid

Molecular weight: 291.0125

Ref: IN-DA000CPK

2-Bromo-3,5-dinitrobenzoic acid

CAS: 116529-60-3

2-Bromo-3,5-dinitrobenzoic acid

Formula: C₇H₃BrN₂O₆

Purity: 98%

Color and Shape: off white / beige needles crystalline powder

Molecular weight: 291.01g/mol

Ref: 54-OR3735

2-Bromo-3,5-dinitrobenzoic acid

CAS: 116529-60-3

Formula: C₇H₃BrN₂O₆

Purity: 98%

Color and Shape: Solid

Molecular weight: 291.013

Ref: 10-F234927