CAS 116529-61-4
:3-bromo-2-nitrobenzoic acid
Description:
3-Bromo-2-nitrobenzoic acid is an aromatic compound characterized by the presence of both a bromine atom and a nitro group attached to a benzoic acid structure. The bromine substituent is located at the meta position relative to the carboxylic acid group, while the nitro group is positioned at the ortho position. This compound typically appears as a crystalline solid and is soluble in organic solvents, with limited solubility in water due to its hydrophobic aromatic structure. It exhibits acidic properties due to the carboxylic acid functional group, which can donate a proton in solution. The presence of the electron-withdrawing nitro group enhances the acidity of the carboxylic acid compared to benzoic acid. 3-Bromo-2-nitrobenzoic acid is often used in organic synthesis and as an intermediate in the production of various pharmaceuticals and agrochemicals. Its reactivity can be influenced by the electron-withdrawing effects of the nitro and bromo groups, making it a valuable compound in chemical research and development.
Formula:C7H4BrNO4
InChI:InChI=1/C7H4BrNO4/c8-5-3-1-2-4(7(10)11)6(5)9(12)13/h1-3H,(H,10,11)
SMILES:c1cc(c(c(c1)Br)N(=O)=O)C(=O)O
Synonyms:- Benzoic Acid, 3-Bromo-2-Nitro-
- 3-Bromo-2-nitrobenzoic acid
- 3-BROMO-2-NITRO-BENZOIC ACID
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
Benzoic acid, 3-bromo-2-nitro-
CAS:Formula:C7H4BrNO4Purity:95%Color and Shape:SolidMolecular weight:246.01503-Bromo-2-nitrobenzoic acid
CAS:3-Bromo-2-nitrobenzoic acidFormula:C7H4BrNO4Purity:≥95%Color and Shape: off white (hint of cream) powderMolecular weight:246.01g/mol3-Bromo-2-nitrobenzoic acid
CAS:3-Bromo-2-nitrobenzoic acid is a synthetic organic solvent that is used in the synthesis of other organic compounds. The chemical synthesis of 3-Bromo-2-nitrobenzoic acid starts with the reaction of acetone and potassium permanganate. The reactants are mixed together and heated to produce a hydrochloric acid solution, which is then cooled to room temperature. This process produces a white solid, which is filtered and washed with water and dried. The chemical synthesis method for 3-Bromo-2-nitrobenzoic acid yields a high yield.Formula:C7H4BrNO4Purity:Min. 95%Molecular weight:246.01 g/mol



