CAS 116530-26-8
:8-Methyl-2-naphthalenamine
Description:
8-Methyl-2-naphthalenamine, with the CAS number 116530-26-8, is an organic compound belonging to the class of naphthalenamines. It features a naphthalene ring system substituted with an amino group and a methyl group, which influences its chemical properties and reactivity. This compound is typically characterized by its solid state at room temperature and exhibits a relatively high melting point. It is known for its potential applications in the synthesis of dyes, pigments, and other organic compounds due to its aromatic structure, which can participate in electrophilic substitution reactions. Additionally, 8-Methyl-2-naphthalenamine may exhibit moderate solubility in organic solvents, while its solubility in water is generally low. Safety considerations are important, as it may pose health risks upon exposure, necessitating proper handling and storage protocols. Overall, this compound is of interest in various fields, including materials science and organic synthesis, due to its unique structural features and functional properties.
Formula:C11H11N
InChI:InChI=1S/C11H11N/c1-8-3-2-4-9-5-6-10(12)7-11(8)9/h2-7H,12H2,1H3
InChI key:InChIKey=ZFPFAGBUMADOCT-UHFFFAOYSA-N
SMILES:CC=1C2=C(C=CC(N)=C2)C=CC1
Synonyms:- 2-Naphthylamine, 8-methyl-
- 8-Methyl-2-naphthalenamine
- 2-Naphthalenamine, 8-methyl-
- 2-Amino-8-methylnaphthalene
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
