CymitQuimica logo

CAS 116530-55-3

:

3-(3-Amino-4-bromophenyl)propanoic acid

Description:
3-(3-Amino-4-bromophenyl)propanoic acid, with the CAS number 116530-55-3, is an organic compound characterized by its structure, which includes an amino group, a bromophenyl moiety, and a propanoic acid functional group. This compound typically exhibits properties associated with both amino acids and aromatic compounds. It is likely to be a white to off-white solid at room temperature and is soluble in polar solvents such as water and alcohols due to the presence of the carboxylic acid and amino groups. The bromine substituent on the aromatic ring can influence its reactivity and biological activity, potentially making it useful in pharmaceutical applications or as a building block in organic synthesis. The presence of the amino group suggests that it may participate in various chemical reactions, including peptide bond formation. Additionally, the compound may exhibit specific biological activities, which could be of interest in medicinal chemistry. Overall, its unique structure and functional groups contribute to its potential utility in various chemical and biological contexts.
Formula:C9H10BrNO2
InChI:InChI=1/C9H10BrNO2/c10-7-3-1-6(5-8(7)11)2-4-9(12)13/h1,3,5H,2,4,11H2,(H,12,13)
SMILES:c1cc(c(cc1CCC(=O)O)N)Br
Synonyms:
  • 3-Amino-4-bromobenzenepropanoic acid
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.