CAS 116538-95-5

Thieno[3,2-b]pyridine-6-carbonitrile

Description:

Thieno[3,2-b]pyridine-6-carbonitrile is a heterocyclic organic compound characterized by its fused thieno and pyridine rings, which contribute to its unique chemical properties. The presence of a carbonitrile group at the 6-position enhances its reactivity and polarity, making it a valuable intermediate in organic synthesis and medicinal chemistry. This compound typically exhibits a planar structure, which can facilitate π-π stacking interactions, potentially influencing its behavior in biological systems. Thieno[3,2-b]pyridine derivatives are known for their diverse biological activities, including potential applications in pharmaceuticals, particularly as kinase inhibitors or in the treatment of various diseases. The compound's solubility and stability can vary depending on the solvent and environmental conditions, which are important factors to consider in practical applications. Additionally, its molecular structure allows for various functionalizations, making it a versatile building block in the development of new chemical entities. Overall, Thieno[3,2-b]pyridine-6-carbonitrile is a significant compound in the field of organic chemistry with promising applications in drug discovery and development.

Formula: C₈H₄N₂S

InChI: InChI=1S/C8H4N2S/c9-4-6-3-8-7(10-5-6)1-2-11-8/h1-3,5H

InChI key: InChIKey=QYCIXUKZMDUDBK-UHFFFAOYSA-N

SMILES: C(#N)C=1C=C2C(=NC1)C=CS2

Synonyms:

• Thieno[3,2-b]pyridine-6-carbonitrile

thieno[3,2-b]pyridine-6-carbonitrile

CAS: 116538-95-5

Formula: C₈H₄N₂S

Molecular weight: 160.1958

Ref: IN-DA000CQ2

THIENO[3,2-B]PYRIDINE-6-CARBONITRILE

CAS: 116538-95-5

Formula: C₈H₄N₂S

Purity: 95.0%

Molecular weight: 160.19

Ref: 10-F501987

Thieno[3,2-b]pyridine-6-carbonitrile

CAS: 116538-95-5

Thiophene-2-carboxylic acid is a heterocyclic compound containing a thiophene ring and carboxylic acid functional groups. Thiophene-2-carboxylic acid is used in the synthesis of β-unsaturated ketones, butyronitrile, acetonitrile, aldehydes, and amines. It also has shown to be an inhibitor of kidney disease, neuropathic pain, and xylene toxicity. The compound is used as an intermediate in the synthesis of polycystic kidney disease drugs. Thiophene-2-carboxylic acid also has anti-cancer properties that are due to its ability to inhibit the growth of cancer cells by inhibiting protein synthesis and inducing apoptosis.

Formula: C₈H₄N₂S

Purity: Min. 95%

Molecular weight: 160.19 g/mol

Ref: 3D-REA53895