CymitQuimica logo

CAS 116538-96-6

:

3-Aminothieno[3,2-b]pyridine-6-carbonitrile

Description:
3-Aminothieno[3,2-b]pyridine-6-carbonitrile is a heterocyclic organic compound characterized by its unique bicyclic structure that incorporates both a thieno and pyridine ring. The presence of an amino group and a cyano group contributes to its reactivity and potential applications in medicinal chemistry. This compound typically exhibits moderate solubility in polar solvents due to the presence of the amino group, which can engage in hydrogen bonding. Its molecular structure suggests potential biological activity, making it a candidate for further research in drug development, particularly in the fields of anti-cancer and anti-inflammatory agents. The compound's stability is influenced by the electronic properties of the heteroatoms in the rings, which can affect its interaction with biological targets. Additionally, its synthesis may involve multi-step reactions, often requiring careful control of reaction conditions to achieve the desired purity and yield. Overall, 3-Aminothieno[3,2-b]pyridine-6-carbonitrile represents a significant compound in the realm of organic synthesis and pharmaceutical research.
Formula:C8H5N3S
InChI:InChI=1S/C8H5N3S/c9-2-5-1-7-8(11-3-5)6(10)4-12-7/h1,3-4H,10H2
InChI key:InChIKey=NDMHPSBWIFCVTR-UHFFFAOYSA-N
SMILES:NC=1C=2C(=CC(C#N)=CN2)SC1
Synonyms:
  • 3-Aminothieno[3,2-b]pyridine-6-carbonitrile
  • Thieno[3,2-b]pyridine-6-carbonitrile, 3-amino-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.