CymitQuimica logo

CAS 116539-04-9

:

Methyl 4-amino-2-methyl-1H-pyrrole-3-carboxylate

Description:
Methyl 4-amino-2-methyl-1H-pyrrole-3-carboxylate is an organic compound characterized by its pyrrole ring structure, which is a five-membered aromatic heterocycle containing nitrogen. This compound features an amino group and a carboxylate ester, contributing to its reactivity and potential applications in organic synthesis. The presence of the methyl group at the 2-position of the pyrrole ring enhances its lipophilicity, which may influence its biological activity. Methyl 4-amino-2-methyl-1H-pyrrole-3-carboxylate is typically a solid at room temperature and may exhibit moderate solubility in polar solvents due to the carboxylate functional group. Its chemical properties make it a candidate for various applications, including pharmaceuticals and agrochemicals, where it may serve as an intermediate in the synthesis of more complex molecules. Additionally, the compound's structure suggests potential for hydrogen bonding and interactions with biological targets, which could be explored in medicinal chemistry. As with any chemical substance, proper handling and safety precautions are essential due to potential toxicity or reactivity.
Formula:C7H10N2O2
InChI:InChI=1S/C7H10N2O2/c1-4-6(7(10)11-2)5(8)3-9-4/h3,9H,8H2,1-2H3
InChI key:InChIKey=GCJCGTKEVLZWIH-UHFFFAOYSA-N
SMILES:C(OC)(=O)C=1C(N)=CNC1C
Synonyms:
  • 1H-Pyrrole-3-carboxylic acid, 4-amino-2-methyl-, methyl ester
  • Methyl 4-amino-2-methyl-1H-pyrrole-3-carboxylate
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.