CymitQuimica logo

CAS 116539-63-0

:

3-(Decyloxy)-6-hydroxy-1,2-benzenedicarbonitrile

Description:
3-(Decyloxy)-6-hydroxy-1,2-benzenedicarbonitrile, with the CAS number 116539-63-0, is an organic compound characterized by its complex structure featuring a benzene ring substituted with hydroxyl and cyano groups, as well as a decyloxy chain. This compound typically exhibits properties associated with both hydrophilic and hydrophobic characteristics due to the presence of the hydroxyl group and the long alkyl chain, respectively. The cyano groups contribute to its potential reactivity and ability to participate in various chemical reactions, including nucleophilic additions. The presence of the decyloxy group may enhance its solubility in organic solvents while limiting its solubility in water. This compound may be of interest in materials science, particularly in the development of organic electronic materials or as a precursor in synthetic organic chemistry. Its specific physical and chemical properties, such as melting point, boiling point, and spectral characteristics, would require empirical measurement or detailed literature references for precise values.
Formula:C18H24N2O2
InChI:InChI=1S/C18H24N2O2/c1-2-3-4-5-6-7-8-9-12-22-18-11-10-17(21)15(13-19)16(18)14-20/h10-11,21H,2-9,12H2,1H3
InChI key:InChIKey=PDJXUNKZQOZUNJ-UHFFFAOYSA-N
SMILES:C(#N)C1=C(OCCCCCCCCCC)C=CC(O)=C1C#N
Synonyms:
  • 3-(Decyloxy)-6-hydroxy-1,2-benzenedicarbonitrile
  • 1,2-Benzenedicarbonitrile, 3-(decyloxy)-6-hydroxy-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.