CymitQuimica logo

CAS 116546-08-8

:

[N(Z)]-4-Methyl-N-(phenylmethylene)benzenamine

Description:
[N(Z)]-4-Methyl-N-(phenylmethylene)benzenamine, with the CAS number 116546-08-8, is an organic compound characterized by its amine functional group and a substituted benzene ring. This compound features a methyl group and a phenylmethylene moiety, which contribute to its structural complexity and potential reactivity. The presence of the amine group indicates that it can participate in hydrogen bonding, influencing its solubility and interaction with other molecules. The compound's aromatic rings suggest stability and potential for π-π stacking interactions, which can affect its physical properties, such as melting and boiling points. Additionally, the substitution pattern on the benzene rings may impart specific electronic properties, making it of interest in various chemical applications, including organic synthesis and materials science. Its unique structure may also lead to interesting biological activities, warranting further investigation in pharmacological contexts. Overall, this compound exemplifies the diverse chemistry associated with substituted anilines and their derivatives.
Formula:C14H13N
InChI:InChI=1S/C14H13N/c1-12-7-9-14(10-8-12)15-11-13-5-3-2-4-6-13/h2-11H,1H3/b15-11-
InChI key:InChIKey=MSFVFFZPHJPOHP-PTNGSMBKSA-N
SMILES:N(=C\C1=CC=CC=C1)\C2=CC=C(C)C=C2
Synonyms:
  • Benzenamine, 4-methyl-N-(phenylmethylene)-, (Z)-
  • [N(Z)]-4-Methyl-N-(phenylmethylene)benzenamine
  • Benzenamine, 4-methyl-N-(phenylmethylene)-, [N(Z)]-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.