CAS 116547-93-4
:2-Butyl-1-(methylsulfonyl)-1H-indole
Description:
2-Butyl-1-(methylsulfonyl)-1H-indole is an organic compound characterized by its indole structure, which consists of a fused benzene and pyrrole ring. The presence of a butyl group and a methylsulfonyl group contributes to its unique chemical properties. This compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents due to its hydrophobic butyl chain and polar sulfonyl group. The methylsulfonyl moiety can enhance the compound's reactivity, potentially allowing for various chemical transformations. Additionally, the indole framework is known for its biological activity, making this compound of interest in medicinal chemistry and pharmacology. Its specific interactions and applications can vary, but it may serve as a precursor or intermediate in the synthesis of more complex molecules. Safety and handling precautions should be observed, as with many organic compounds, to mitigate any potential hazards associated with its use.
Formula:C13H17NO2S
InChI:InChI=1S/C13H17NO2S/c1-3-4-8-12-10-11-7-5-6-9-13(11)14(12)17(2,15)16/h5-7,9-10H,3-4,8H2,1-2H3
InChI key:InChIKey=QWEBFMDHKFYXOG-UHFFFAOYSA-N
SMILES:S(C)(=O)(=O)N1C=2C(C=C1CCCC)=CC=CC2
Synonyms:- 1H-Indole, 2-butyl-1-(methylsulfonyl)-
- 2-Butyl-1-(methylsulfonyl)-1H-indole
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
