CymitQuimica logo

CAS 116568-95-7

:

4-Thiazolepropanoic acid, 2-amino-, methyl ester, hydrobromide (1:1)

Description:
4-Thiazolepropanoic acid, 2-amino-, methyl ester, hydrobromide (1:1) is a chemical compound characterized by its thiazole ring, which contributes to its heterocyclic nature. This compound features a propanoic acid backbone with an amino group and a methyl ester functional group, indicating it has both acidic and basic properties. The hydrobromide salt form suggests that it is a stable, ionic compound, enhancing its solubility in polar solvents, particularly water. The presence of the thiazole moiety often imparts biological activity, making such compounds of interest in pharmaceutical research. The molecular structure allows for potential interactions with biological targets, which may lead to various applications in medicinal chemistry. Additionally, the compound's properties, such as melting point, solubility, and reactivity, can be influenced by the presence of the hydrobromide salt. Overall, this compound exemplifies the complexity and versatility of thiazole derivatives in chemical and biological contexts.
Formula:C7H10N2O2S·BrH
InChI:InChI=1S/C7H10N2O2S.BrH/c1-11-6(10)3-2-5-4-12-7(8)9-5;/h4H,2-3H2,1H3,(H2,8,9);1H
InChI key:InChIKey=FBAIQOUEPFAAGX-UHFFFAOYSA-N
SMILES:C(CC(OC)=O)C1=CSC(N)=N1.Br
Synonyms:
  • 4-Thiazolepropanoic acid, 2-amino-, methyl ester, hydrobromide (1:1)
  • 4-Thiazolepropionic acid, 2-amino-, methyl ester, hydrobromide
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.