CAS 116569-09-6

5-Hydroxyisatin

Description:

5-Hydroxyisatin is an organic compound characterized by its indole structure, featuring a hydroxyl group at the 5-position of the isatin moiety. It is a derivative of isatin, which is known for its diverse biological activities, including antimicrobial, anticancer, and anti-inflammatory properties. The presence of the hydroxyl group enhances its reactivity and solubility in polar solvents. 5-Hydroxyisatin typically exhibits a yellow to orange color in solid form and can be synthesized through various chemical reactions involving isatin and hydroxylating agents. Its molecular structure allows for potential interactions with biological targets, making it a subject of interest in medicinal chemistry. Additionally, it may participate in various chemical reactions, such as condensation and oxidation, which can lead to the formation of more complex compounds. Due to its unique properties, 5-Hydroxyisatin is studied for its potential applications in pharmaceuticals and as a building block in organic synthesis.

Formula: C₈H₅NO₃

InChI: InChI=1S/C8H5NO3/c10-4-1-2-6-5(3-4)7(11)8(12)9-6/h1-3,10H,(H,9,11,12)

InChI key: InChIKey=SZEUAVRUUFUMIU-UHFFFAOYSA-N

SMILES: O=C1C=2C(NC1=O)=CC=C(O)C2

Synonyms:

• 1H-Indole-2,3-dione, 5-hydroxy-
• Isatin, 5-hydroxy-
• 5-Hydroxy-1H-indole-2,3-dione
• 5-Hydroxyisatin
• 5-Hydroxyindoline-2,3-dione

1H-Indole-2,3-dione, 5-hydroxy-

CAS: 116569-09-6

Formula: C₈H₅NO₃

Purity: 95%

Color and Shape: Solid

Molecular weight: 163.1302

Ref: IN-DA000CT7

5-Hydroxyindoline-2,3-dione

CAS: 116569-09-6

Purity: 95%

Molecular weight: 163.1320038

Ref: 10-F621606

5-Hydroxy-2,3-dihydro-1H-indole-2,3-dione

CAS: 116569-09-6

5-Hydroxy-2,3-dihydro-1H-indole-2,3-dione is a growth factor that has been shown to have an inhibitory effect on the production of indirubin and oxindole. It has been found to be effective against infectious diseases such as malaria, leishmaniasis and toxoplasmosis. This molecule also has an inhibitory effect on oxidases, which are enzymes that catalyze the oxidation of various substrates. 5-Hydroxy-2,3-dihydro-1H-indole-2,3-dione can be modified by enzymes to form a variety of derivatives with different biological activities. 5HIDD binds to cell membrane receptors and inhibits insulin like growth factor binding protein 3 (IGFBP3) and insulin receptor substrate 1 (IRS1).

Formula: C₈H₅NO₃

Purity: Min. 95%

Molecular weight: 163.13 g/mol

Ref: 3D-REA56909

5-hydroxy Isatin

CAS: 116569-09-6

5-hydroxy Isatin inhibits MAO-A and ANP-induced particulate guanylyl cyclase in rat brain/heart.

Formula: C₈H₅NO₃

Color and Shape: Solid

Molecular weight: 163.13

Ref: TM-T71987