CymitQuimica logo

CAS 116570-41-3

:

5,7-difluoro-1H-indole-2,3-dione

Description:
5,7-Difluoro-1H-indole-2,3-dione, with the CAS number 116570-41-3, is a synthetic organic compound characterized by its indole structure, which is a bicyclic compound consisting of a benzene ring fused to a pyrrole ring. The presence of two fluorine atoms at the 5 and 7 positions of the indole ring significantly influences its chemical properties, including its reactivity and polarity. The dione functional groups at positions 2 and 3 contribute to its potential as a versatile building block in organic synthesis, particularly in the development of pharmaceuticals and agrochemicals. This compound may exhibit interesting biological activities due to its structural features, making it a subject of research in medicinal chemistry. Additionally, its stability and solubility in various solvents can vary, which is important for its application in different chemical reactions. Overall, 5,7-difluoro-1H-indole-2,3-dione represents a valuable compound in the field of organic chemistry with potential applications in drug discovery and development.
Formula:C8H3F2NO2
InChI:InChI=1/C8H3F2NO2/c9-3-1-4-6(5(10)2-3)11-8(13)7(4)12/h1-2H,(H,11,12,13)
SMILES:c1c(cc(c2c1C(=O)C(=O)N2)F)F
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.