CymitQuimica logo

CAS 1165801-18-2

:

2-Bromo-7-quinolinol

Description:
2-Bromo-7-quinolinol is a chemical compound characterized by its quinoline structure, which consists of a fused benzene and pyridine ring. The presence of a bromine atom at the second position and a hydroxyl group at the seventh position contributes to its unique properties. This compound typically appears as a solid and is soluble in organic solvents, reflecting its aromatic nature. It exhibits potential biological activity, making it of interest in medicinal chemistry and drug development. The hydroxyl group can participate in hydrogen bonding, influencing its reactivity and interactions with other molecules. Additionally, the bromine substituent can enhance the compound's electrophilic character, facilitating further chemical modifications. Safety data should be consulted, as halogenated compounds can pose health risks. Overall, 2-Bromo-7-quinolinol serves as a valuable intermediate in organic synthesis and may have applications in various fields, including pharmaceuticals and agrochemicals.
Formula:C9H6BrNO
InChI:InChI=1S/C9H6BrNO/c10-9-4-2-6-1-3-7(12)5-8(6)11-9/h1-5,12H
InChI key:InChIKey=WNBFCGIKXRRCCF-UHFFFAOYSA-N
SMILES:OC1=CC2=C(C=CC(Br)=N2)C=C1
Synonyms:
  • 2-Bromo-7-quinolinol
  • 7-Quinolinol, 2-bromo-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.