CAS 116585-72-9
:2-(2-azabicyclo[2.2.1]hept-2-yl)ethanol
Description:
2-(2-Azabicyclo[2.2.1]hept-2-yl)ethanol, with the CAS number 116585-72-9, is a bicyclic compound featuring a nitrogen atom within its bicyclic structure, which contributes to its unique properties. This substance is characterized by its azabicyclic framework, which consists of a seven-membered ring containing one nitrogen atom, and an ethanol moiety that introduces a hydroxyl (-OH) group. The presence of the hydroxyl group enhances its solubility in polar solvents and can influence its reactivity, making it a potential candidate for various chemical reactions, including those involving nucleophilic substitution. The bicyclic structure may also impart rigidity, affecting the compound's conformational dynamics and interactions with biological targets. Additionally, compounds with similar structures are often investigated for their pharmacological properties, including potential applications in medicinal chemistry. Overall, 2-(2-azabicyclo[2.2.1]hept-2-yl)ethanol represents a fascinating example of a nitrogen-containing bicyclic compound with diverse potential applications in research and industry.
Formula:C8H15NO
InChI:InChI=1/C8H15NO/c10-4-3-9-6-7-1-2-8(9)5-7/h7-8,10H,1-6H2
SMILES:C1CC2CC1CN2CCO
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
