CymitQuimica logo

CAS 116598-88-0

:

Pyrido[3,2-d]pyrimidin-2(1H)-one

Description:
Pyrido[3,2-d]pyrimidin-2(1H)-one is a heterocyclic organic compound characterized by a fused ring system that incorporates both pyridine and pyrimidine structures. This compound typically exhibits a planar structure due to the conjugated system of double bonds, which contributes to its stability and potential reactivity. It is often recognized for its biological activity, particularly in medicinal chemistry, where it may serve as a scaffold for the development of pharmaceuticals. The presence of the carbonyl group at the 2-position enhances its ability to participate in hydrogen bonding and may influence its solubility and interaction with biological targets. Pyrido[3,2-d]pyrimidin-2(1H)-one may also exhibit fluorescence properties, making it useful in various analytical applications. Its chemical behavior can be influenced by substituents on the ring, which can modulate its electronic properties and reactivity. Overall, this compound is of interest in both synthetic and medicinal chemistry due to its unique structural features and potential applications.
Formula:C7H5N3O
InChI:InChI=1S/C7H5N3O/c11-7-9-4-6-5(10-7)2-1-3-8-6/h1-4H,(H,9,10,11)
InChI key:InChIKey=IAAQUOVTPAMQCR-UHFFFAOYSA-N
SMILES:O=C1NC=2C(C=N1)=NC=CC2
Synonyms:
  • Pyrido[3,2-d]pyrimidin-2-ol
  • Pyrido[3,2-d]pyrimidin-2(1H)-one
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.