CymitQuimica logo

CAS 116599-52-1

:

3H-1,2,3-Triazolo[4,5-b]pyridine-5-sulfonamide

Description:
3H-1,2,3-Triazolo[4,5-b]pyridine-5-sulfonamide is a heterocyclic compound characterized by its unique triazole and pyridine ring structures, which contribute to its chemical reactivity and biological activity. This compound features a sulfonamide functional group, which enhances its solubility in polar solvents and can influence its pharmacological properties. The presence of the triazole ring provides potential for coordination with metal ions and may exhibit antimicrobial or antitumor activity, making it of interest in medicinal chemistry. Its molecular structure allows for various interactions with biological targets, potentially leading to the development of novel therapeutic agents. The compound is typically synthesized through specific organic reactions that involve the formation of the triazole and subsequent sulfonamide attachment. As with many sulfonamides, it may exhibit properties such as antibacterial activity, although the specific biological effects can vary based on the substituents and overall molecular configuration. Safety and handling precautions are essential due to potential toxicity and reactivity associated with sulfonamide compounds.
Formula:C5H5N5O2S
InChI:InChI=1S/C5H5N5O2S/c6-13(11,12)4-2-1-3-5(7-4)9-10-8-3/h1-2H,(H2,6,11,12)(H,7,8,9,10)
InChI key:InChIKey=DHOMHNXWWGFVMX-UHFFFAOYSA-N
SMILES:S(N)(=O)(=O)C=1N=C2C(=CC1)NN=N2
Synonyms:
  • 3H-1,2,3-Triazolo[4,5-b]pyridine-5-sulfonamide
  • v-Triazolo[4,5-b]pyridine-5-sulfonamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.