
CAS 116599-56-5
:5,6-Dimethyl-3H-imidazo[4,5-b]pyridine
Description:
5,6-Dimethyl-3H-imidazo[4,5-b]pyridine is a heterocyclic organic compound characterized by its fused imidazole and pyridine rings, which contribute to its unique chemical properties. This compound features two methyl groups at the 5 and 6 positions of the imidazole ring, influencing its reactivity and solubility. It is typically a solid at room temperature and exhibits moderate polarity due to the presence of nitrogen atoms in its structure. The compound is of interest in medicinal chemistry, particularly for its potential biological activities, including antimicrobial and anticancer properties. Its molecular structure allows for various interactions with biological targets, making it a subject of research in drug development. Additionally, 5,6-Dimethyl-3H-imidazo[4,5-b]pyridine can participate in various chemical reactions, including electrophilic substitutions and nucleophilic attacks, due to the electron-rich nature of the nitrogen atoms. Safety and handling precautions should be observed, as with many organic compounds, to mitigate any potential hazards associated with its use.
Formula:C8H9N3
InChI:InChI=1S/C8H9N3/c1-5-3-7-8(10-4-9-7)11-6(5)2/h3-4H,1-2H3,(H,9,10,11)
InChI key:InChIKey=GZHRJZDAOSOXBU-UHFFFAOYSA-N
SMILES:CC=1C=C2C(=NC1C)N=CN2
Synonyms:- 5,6-Dimethyl-3H-imidazo[4,5-b]pyridine
- Imidazo[4,5-b]pyridine, 5,6-dimethyl-
- 3H-Imidazo[4,5-b]pyridine, 5,6-dimethyl-
- 1H-Imidazo[4,5-b]pyridine, 5,6-dimethyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.