
CAS 1166-12-7
:1-(2,4-Dihydroxyphenyl)ethanone 2-(2,4-dinitrophenyl)hydrazone
Description:
1-(2,4-Dihydroxyphenyl)ethanone 2-(2,4-dinitrophenyl)hydrazone, with CAS number 1166-12-7, is a chemical compound characterized by its hydrazone functional group, which is formed through the reaction of a hydrazine derivative with a carbonyl compound. This substance typically exhibits a yellow to orange coloration due to the presence of the dinitrophenyl group, which is known for its strong electron-withdrawing properties. The compound is likely to be soluble in organic solvents, reflecting the hydrophobic nature of the dinitrophenyl moiety. It may also display significant biological activity, potentially serving as a reagent in various chemical reactions or as an indicator in analytical chemistry. The presence of hydroxyl groups suggests that it may engage in hydrogen bonding, influencing its solubility and reactivity. Additionally, the compound's structure may allow for various tautomeric forms, which can affect its stability and reactivity under different conditions. Overall, this compound is of interest in both synthetic organic chemistry and potential applications in biological systems.
Formula:C14H12N4O6
InChI:InChI=1S/C14H12N4O6/c1-8(11-4-3-10(19)7-14(11)20)15-16-12-5-2-9(17(21)22)6-13(12)18(23)24/h2-7,16,19-20H,1H3
InChI key:InChIKey=AXYZBIJYZKKFRR-UHFFFAOYSA-N
SMILES:N(N=C(C)C1=C(O)C=C(O)C=C1)C2=C(N(=O)=O)C=C(N(=O)=O)C=C2
Synonyms:- Ethanone, 1-(2,4-dihydroxyphenyl)-, 2-(2,4-dinitrophenyl)hydrazone
- Acetophenone, 2′,4′-dihydroxy-, (2,4-dinitrophenyl)hydrazone
- 1-(2,4-Dihydroxyphenyl)ethanone 2-(2,4-dinitrophenyl)hydrazone
- Ethanone, 1-(2,4-dihydroxyphenyl)-, (2,4-dinitrophenyl)hydrazone
- Resacetophenone 2,4-dinitrophenyl hydrazone
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Ethanone, 1-(2,4-dihydroxyphenyl)-, 2-(2,4-dinitrophenyl)hydrazone
CAS:Formula:C14H12N4O6Molecular weight:332.2683
