CymitQuimica logo

CAS 116609-87-1

:

3,3-BIS-METHYLSULFANYL-1-(4-TRIFLUOROMETHYL-PHENYL)-PROPENONE

Description:
3,3-Bis-methylsulfanyl-1-(4-trifluoromethyl-phenyl)-propenone, identified by its CAS number 116609-87-1, is an organic compound characterized by its unique structure that includes a propenone moiety and two methylsulfanyl groups. This compound features a trifluoromethyl group attached to a phenyl ring, which contributes to its distinctive chemical properties, including increased lipophilicity and potential reactivity. The presence of sulfur atoms in the methylsulfanyl groups can enhance its nucleophilicity, making it useful in various chemical reactions. Additionally, the trifluoromethyl group is known for imparting unique electronic properties, which can influence the compound's behavior in biological systems and its interactions with other molecules. The compound may exhibit interesting photochemical properties due to its conjugated system, making it a candidate for applications in materials science and organic synthesis. However, specific safety and handling guidelines should be followed, as with any chemical substance, to mitigate potential hazards associated with its use.
Formula:C12H11F3OS2
InChI:InChI=1/C12H11F3OS2/c1-17-11(18-2)7-10(16)8-3-5-9(6-4-8)12(13,14)15/h3-7H,1-2H3
SMILES:CSC(=CC(=O)c1ccc(cc1)C(F)(F)F)SC
Synonyms:
  • 3,3-Bis(Methylsulfanyl)-1-[4-(Trifluoromethyl)Phenyl]Prop-2-En-1-One
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.