CymitQuimica logo

CAS 116609-88-2

:

3,3-BIS-METHYLSULFANYL-1-(3-TRIFLUOROMETHYL-PHENYL)-PROPENONE

Description:
3,3-Bis-methylsulfanyl-1-(3-trifluoromethyl-phenyl)-propenone, identified by its CAS number 116609-88-2, is an organic compound characterized by its unique structure that includes a propenone moiety and two methylsulfanyl groups. This compound features a trifluoromethyl group, which significantly influences its chemical properties, including increased lipophilicity and potential reactivity. The presence of sulfur atoms in the methylsulfanyl groups can impart distinctive electronic properties, making it a candidate for various chemical reactions, including nucleophilic substitutions. The trifluoromethyl group enhances the compound's stability and can affect its biological activity, making it of interest in medicinal chemistry. Additionally, the compound's structural features suggest potential applications in materials science and organic synthesis. However, specific physical properties such as melting point, boiling point, and solubility would require experimental determination or literature reference for precise values. Overall, this compound exemplifies the complexity and versatility of organosulfur and fluorinated compounds in chemical research.
Formula:C12H11F3OS2
InChI:InChI=1/C12H11F3OS2/c1-17-11(18-2)7-10(16)8-4-3-5-9(6-8)12(13,14)15/h3-7H,1-2H3
SMILES:CSC(=CC(=O)c1cccc(c1)C(F)(F)F)SC
Synonyms:
  • 3,3-Bis(Methylsulfanyl)-1-[3-(Trifluoromethyl)Phenyl]Prop-2-En-1-One
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.