CymitQuimica logo

CAS 116609-89-3

:

1-(3-FLUORO-PHENYL)-3,3-BIS-METHYLSULFANYL-PROPENONE

Description:
1-(3-Fluoro-phenyl)-3,3-bis-methylsulfanylp-ropenone, identified by its CAS number 116609-89-3, is an organic compound characterized by its unique structure that includes a propenone moiety and two methylsulfanyl groups. The presence of a fluorine atom on the phenyl ring enhances its electronic properties, potentially influencing its reactivity and interactions with biological systems. This compound is likely to exhibit a range of chemical behaviors typical of propenones, such as undergoing nucleophilic addition reactions due to the electrophilic nature of the carbonyl group. The methylsulfanyl substituents can also impart distinct steric and electronic effects, which may affect the compound's solubility and stability. Additionally, the compound's structural features suggest potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, where modifications to the phenyl ring and the propenone structure can lead to varied biological activities. Overall, this compound represents a fascinating example of how subtle changes in molecular structure can significantly influence chemical properties and potential applications.
Formula:C11H11FOS2
InChI:InChI=1/C11H11FOS2/c1-14-11(15-2)7-10(13)8-4-3-5-9(12)6-8/h3-7H,1-2H3
SMILES:CSC(=CC(=O)c1cccc(c1)F)SC
Synonyms:
  • 1-(3-Fluorophenyl)-3,3-Bis(Methylsulfanyl)Prop-2-En-1-One
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.