CAS 116611-59-7

N-[(1,1-Dimethylethoxy)carbonyl]-D-norleucine methyl ester

Description:

N-[(1,1-Dimethylethoxy)carbonyl]-D-norleucine methyl ester is a chemical compound characterized by its unique structure, which includes a norleucine backbone modified with a dimethylethoxycarbonyl group and a methyl ester functional group. This compound is typically used in peptide synthesis and as an intermediate in organic synthesis due to its ability to protect amino groups during reactions. The presence of the dimethylethoxycarbonyl group provides steric hindrance, which can influence the reactivity and selectivity of the compound in various chemical processes. Additionally, the methyl ester group enhances solubility in organic solvents, making it suitable for various applications in medicinal chemistry and biochemistry. The compound's stability and reactivity can be affected by environmental factors such as pH and temperature, which are important considerations in its handling and application. Overall, N-[(1,1-Dimethylethoxy)carbonyl]-D-norleucine methyl ester is a valuable building block in the synthesis of more complex molecules.

Formula: C₁₂H₂₃NO₄

InChI: InChI=1S/C12H23NO4/c1-6-7-8-9(10(14)16-5)13-11(15)17-12(2,3)4/h9H,6-8H2,1-5H3,(H,13,15)/t9-/m1/s1

InChI key: InChIKey=ROZBCRMGQFLYFJ-SECBINFHSA-N

SMILES: [C@@H](C(OC)=O)(NC(OC(C)(C)C)=O)CCCC

Synonyms:

• N-[(1,1-Dimethylethoxy)carbonyl]-D-norleucine methyl ester
• D-Norleucine, N-[(1,1-dimethylethoxy)carbonyl]-, methyl ester