CymitQuimica logo

CAS 116613-81-1

:

Tert-Butyl (S)-(1-Hydroxypent-4-En-2-Yl)Carbamate

Description:
Tert-Butyl (S)-(1-Hydroxypent-4-En-2-Yl)Carbamate is a chemical compound characterized by its carbamate functional group, which is derived from the reaction of an amine with a carbonyl compound. This substance features a tert-butyl group, providing steric hindrance and influencing its reactivity and solubility. The presence of the hydroxyl group contributes to its potential as a chiral building block in organic synthesis, particularly in the development of pharmaceuticals. The (S) configuration indicates that it is a chiral molecule, which can exhibit different biological activities compared to its enantiomer. Its structure includes a pentene chain, which may impart unique properties related to its reactivity and interaction with other molecules. The compound is typically used in synthetic organic chemistry and may serve as an intermediate in the synthesis of more complex molecules. Safety data and handling precautions should be observed, as with any chemical substance, to ensure safe laboratory practices.
Formula:C10H19NO3
InChI:InChI=1S/C10H19NO3/c1-5-6-8(7-12)11-9(13)14-10(2,3)4/h5,8,12H,1,6-7H2,2-4H3,(H,11,13)/t8-/m0/s1
InChI key:ABDSMVSRKFOYMR-QMMMGPOBSA-N
SMILES:CC(C)(C)OC(=O)N[C@@H](CC=C)CO
Found 5 products.