CAS 116622-96-9

3-(Trifluoromethyl)benzeneacetic acid hydrazide

Description:

3-(Trifluoromethyl)benzeneacetic acid hydrazide, with the CAS number 116622-96-9, is a chemical compound characterized by the presence of a trifluoromethyl group attached to a benzene ring, along with a hydrazide functional group. This compound typically exhibits properties associated with both aromatic and hydrazide functionalities, which may influence its reactivity and solubility. The trifluoromethyl group is known for imparting unique electronic properties, enhancing lipophilicity, and potentially increasing the compound's biological activity. The hydrazide moiety can participate in various chemical reactions, including condensation and hydrazone formation, making it a versatile intermediate in organic synthesis. Additionally, compounds containing trifluoromethyl groups are often studied for their applications in pharmaceuticals and agrochemicals due to their ability to modulate biological activity. Overall, 3-(Trifluoromethyl)benzeneacetic acid hydrazide is of interest in both synthetic chemistry and medicinal chemistry contexts, although specific applications and biological activities would require further investigation.

Formula: C₉H₉F₃N₂O

InChI: InChI=1S/C9H9F3N2O/c10-9(11,12)7-3-1-2-6(4-7)5-8(15)14-13/h1-4H,5,13H2,(H,14,15)

InChI key: InChIKey=JNALJBUPABHFKK-UHFFFAOYSA-N

SMILES: C(C(NN)=O)C1=CC(C(F)(F)F)=CC=C1

Synonyms:

• Benzeneacetic acid, 3-(trifluoromethyl)-, hydrazide
• 2-[3-(Trifluoromethyl)phenyl]acetohydrazide
• (3-Trifluoromethylphenyl)acetic acid hydrazide
• 2-(3-(Trifluoromethyl)phenyl)acetic hydrazide
• 3-(Trifluoromethyl)benzeneacetic acid hydrazide