
CAS 1166254-80-3
:L-Arginyl-2,5,7-tris(1,1-dimethylethyl)-L-tryptophyl-N-(2-phenylethyl)-L-argininamide
Description:
L-Arginyl-2,5,7-tris(1,1-dimethylethyl)-L-tryptophyl-N-(2-phenylethyl)-L-argininamide is a synthetic compound characterized by its complex structure, which includes multiple amino acid residues and bulky side chains. This compound features arginine and tryptophan, both of which are essential amino acids known for their roles in protein synthesis and various biological functions. The presence of tert-butyl groups contributes to its hydrophobic characteristics, potentially influencing its solubility and interaction with biological membranes. The phenylethyl group may enhance its binding affinity to specific receptors or enzymes. As a derivative of arginine, this compound may exhibit properties related to nitric oxide synthesis and vasodilation, while the tryptophan component could be linked to neurotransmitter activity. Overall, the unique combination of functional groups and amino acid residues suggests potential applications in pharmacology or biochemistry, although specific biological activities and therapeutic uses would require further investigation through empirical studies.
Formula:C43H69N11O3
InChI:InChI=1S/C43H69N11O3/c1-41(2,3)27-23-28-29(35(43(7,8)9)54-34(28)30(24-27)42(4,5)6)25-33(53-36(55)31(44)17-13-20-50-39(45)46)38(57)52-32(18-14-21-51-40(47)48)37(56)49-22-19-26-15-11-10-12-16-26/h10-12,15-16,23-24,31-33,54H,13-14,17-22,25,44H2,1-9H3,(H,49,56)(H,52,57)(H,53,55)(H4,45,46,50)(H4,47,48,51)/t31-,32-,33-/m0/s1
InChI key:InChIKey=ZVOYWSKEBVVLGW-ZDCRTTOTSA-N
SMILES:C([C@@H](C(N[C@H](C(NCCC1=CC=CC=C1)=O)CCCNC(=N)N)=O)NC([C@H](CCCNC(=N)N)N)=O)C=2C=3C(=C(C(C)(C)C)C=C(C(C)(C)C)C3)NC2C(C)(C)C
Synonyms:- LTX 109
- L-Arginyl-2,5,7-tris(1,1-dimethylethyl)-L-tryptophyl-N-(2-phenylethyl)-L-argininamide
- L-Argininamide, L-arginyl-2,5,7-tris(1,1-dimethylethyl)-L-tryptophyl-N-(2-phenylethyl)-
- Voxvoganan
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Voxvoganan
CAS:Lytixar (LTX-109): Synthetic peptide effective against various resistant S. aureus strains, MIC 2-4 μg/ml, fast-acting regardless of prior resistance.Formula:C43H69N11O3Color and Shape:SolidMolecular weight:788.08
