CymitQuimica logo

CAS 116627-49-7

:

11-(3-Methyl-5-propylfuran-2-yl)undecanoic acid

Description:
11-(3-Methyl-5-propylfuran-2-yl)undecanoic acid, with the CAS number 116627-49-7, is an organic compound characterized by its long hydrocarbon chain and a furan ring substituted with a methyl and propyl group. This substance features a carboxylic acid functional group, which contributes to its acidity and potential reactivity. The presence of the furan ring indicates that it may exhibit unique electronic properties and potential for participating in various chemical reactions, such as electrophilic substitutions or polymerizations. The long undecanoic acid chain suggests that it may have amphiphilic characteristics, making it relevant in applications such as surfactants or emulsifiers. Additionally, the branched alkyl substituents can influence its solubility and melting point, potentially making it more soluble in organic solvents than in water. Overall, this compound's structure suggests it may have applications in fields such as materials science, organic synthesis, or as a potential bioactive compound, although specific applications would depend on further research and characterization.
Formula:C19H32O3
InChI:InChI=1S/C19H32O3/c1-3-12-17-15-16(2)18(22-17)13-10-8-6-4-5-7-9-11-14-19(20)21/h15H,3-14H2,1-2H3,(H,20,21)
InChI key:InChIKey=XZOBJEOEOJXQBF-UHFFFAOYSA-N
SMILES:C(CCCCCCCCCC(O)=O)C=1OC(CCC)=CC1C
Synonyms:
  • 11-(3-Methyl-5-propylfuran-2-yl)undecanoic acid
  • 3-Methyl-5-propyl-2-furanundecanoic acid
  • 2-Furanundecanoic acid, 3-methyl-5-propyl-
  • 12,15-Epoxy-13-methyloctadeca-12,14-dienoic acid
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.