CymitQuimica logo

CAS 116632-38-3

:

3-BROMO-5-IODOTOLUENE

Description:
3-Bromo-5-iodotoluene is an organic compound characterized by the presence of both bromine and iodine substituents on a toluene ring. Specifically, the bromine atom is located at the meta position (3-position) and the iodine atom at the para position (5-position) relative to the methyl group of the toluene. This compound is typically a colorless to pale yellow liquid or solid, depending on its purity and form. It is notable for its reactivity, particularly in electrophilic aromatic substitution reactions, due to the electron-withdrawing effects of the halogen substituents. The presence of both bromine and iodine can influence its chemical behavior, making it a useful intermediate in organic synthesis, particularly in the development of pharmaceuticals and agrochemicals. Additionally, 3-bromo-5-iodotoluene may exhibit interesting physical properties such as solubility in organic solvents and varying melting and boiling points, which are influenced by the halogen substituents. Safety precautions should be taken when handling this compound, as halogenated compounds can pose health risks.
Formula:C7H6BrI
InChI:InChI=1/C7H6BrI/c1-5-2-6(8)4-7(9)3-5/h2-4H,1H3
InChI key:CJNMQLWBTZQNAM-UHFFFAOYSA-N
SMILES:Cc1cc(cc(c1)I)Br
Synonyms:
  • 1-Bromo-3-Iodo-5-Methylbenzene
Found 4 products.