CymitQuimica logo

CAS 116632-58-7

:

8-Bromo-5-quinolinamine

Description:
8-Bromo-5-quinolinamine is an organic compound characterized by its quinoline structure, which features a bromine atom at the 8-position and an amino group at the 5-position of the quinoline ring. This compound typically appears as a solid and is known for its potential applications in medicinal chemistry, particularly in the development of pharmaceuticals due to its biological activity. The presence of the bromine substituent can influence the compound's reactivity and solubility, while the amino group may participate in hydrogen bonding, enhancing its interaction with biological targets. 8-Bromo-5-quinolinamine may exhibit properties such as fluorescence, making it useful in various analytical applications. Additionally, its synthesis often involves bromination and subsequent amination reactions, which are common in organic synthesis. As with many quinoline derivatives, it may also display antimicrobial or antitumor activity, although specific biological effects would depend on further empirical studies. Proper handling and safety measures are essential due to the potential toxicity associated with brominated compounds.
Formula:C9H7BrN2
InChI:InChI=1S/C9H7BrN2/c10-7-3-4-8(11)6-2-1-5-12-9(6)7/h1-5H,11H2
InChI key:InChIKey=UNFYSPONYGTMNH-UHFFFAOYSA-N
SMILES:NC=1C2=C(C(Br)=CC1)N=CC=C2
Synonyms:
  • 8-Bromo-5-quinolinamine
  • 5-Quinolinamine, 8-bromo-
  • 5-Amino-8-bromoquinoline
Found 5 products.