CAS 1166392-43-3
:1H-Inden-1-amine, 2,3-dihydro-N-2-propen-1-yl-, (1R)-, ethanedioate (1:?)
Description:
1H-Inden-1-amine, 2,3-dihydro-N-2-propen-1-yl-, (1R)-, ethanedioate (1:?) is a chemical compound characterized by its unique structure, which includes an indene ring fused with an amine group and a propenyl substituent. The compound features a chiral center, indicated by the (1R) designation, which implies specific stereochemistry that can influence its biological activity and interactions. The ethanedioate component suggests the presence of an oxalic acid derivative, which may contribute to the compound's solubility and reactivity. This substance is likely to exhibit properties typical of amines, such as basicity and the ability to form hydrogen bonds, which can affect its behavior in various chemical environments. Additionally, the presence of the double bond in the propenyl group may allow for further chemical reactivity, such as addition reactions. Overall, the compound's characteristics make it of interest in fields such as medicinal chemistry and materials science, where its unique structural features can be leveraged for specific applications.
Formula:C12H15N·xC2H2O4
InChI:InChI=1S/C12H15N.C2H2O4/c1-2-9-13-12-8-7-10-5-3-4-6-11(10)12;3-1(4)2(5)6/h2-6,12-13H,1,7-9H2;(H,3,4)(H,5,6)/t12-;/m1./s1
InChI key:InChIKey=KGFWCWSROCOLAN-UTONKHPSSA-N
SMILES:N(CC=C)[C@H]1C=2C(CC1)=CC=CC2.C(C(O)=O)(O)=O
Synonyms:- 1H-Inden-1-amine, 2,3-dihydro-N-2-propen-1-yl-, (1R)-, ethanedioate (1:?)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
(1R)-2,3-Dihydro-N-2-propen-1-yl-1H-inden-1-amine Ethanedioate
CAS:Controlled Product<p>Applications (1R)-2,3-Dihydro-N-2-propen-1-yl-1H-inden-1-amine Ethanedioate is an intermediate used in the synthesis of propargylated aminoindan derivatives via allylation, bromination, dehalogenation sequence.<br>References Phull, M., et al.: PCT Int. Appl., WO 2009081148 A1 20090702 (2009)<br></p>Formula:C21H23NO10Color and Shape:NeatMolecular weight:449.408
