CAS 116661-86-0
:N-Boc-(2R,3R)-2-Hydroxy-3-Amino-4-Phenylbutanoic Acid
Description:
N-Boc-(2R,3R)-2-Hydroxy-3-Amino-4-Phenylbutanoic Acid is a chemical compound characterized by its specific stereochemistry and functional groups. The "N-Boc" designation indicates the presence of a tert-butyloxycarbonyl (Boc) protecting group on the amino functionality, which is commonly used in peptide synthesis to protect amines. The compound features a hydroxy group and an amino group, contributing to its potential as a chiral building block in pharmaceutical chemistry. The presence of a phenyl group enhances its hydrophobic characteristics, influencing solubility and interaction with biological systems. This compound is typically utilized in the synthesis of peptides and other biologically active molecules due to its ability to participate in various chemical reactions while maintaining the integrity of its functional groups. Its specific stereochemistry (2R,3R) is crucial for its biological activity, as chirality can significantly affect the pharmacological properties of compounds. Overall, N-Boc-(2R,3R)-2-Hydroxy-3-Amino-4-Phenylbutanoic Acid is an important intermediate in organic synthesis and medicinal chemistry.
Formula:C15H21NO5
InChI:InChI=1/C15H21NO5/c1-15(2,3)21-14(20)16-11(12(17)13(18)19)9-10-7-5-4-6-8-10/h4-8,11-12,17H,9H2,1-3H3,(H,16,20)(H,18,19)/t11-,12-/m0/s1
SMILES:CC(C)(C)OC(=N[C@@H](Cc1ccccc1)[C@@H](C(=O)O)O)O
Synonyms:- (2S,3S)-3-[(tert-butoxycarbonyl)amino]-2-hydroxy-4-phenylbutanoic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
N-Boc-(2S,3S)-3-amino-2-hydroxy-4-phenyl-butyric acid
CAS:Formula:C15H21NO5Color and Shape:SolidMolecular weight:295.3309
