
CAS 116664-93-8
:7H-Naphtho[1,2,3-ij][2,7]naphthyridin-7-one
Description:
7H-Naphtho[1,2,3-ij][2,7]naphthyridin-7-one, identified by its CAS number 116664-93-8, is a heterocyclic compound characterized by a fused ring system that incorporates both naphthalene and naphthyridine structures. This compound features a nitrogen atom within its bicyclic framework, contributing to its unique chemical properties. It typically exhibits a planar structure, which can facilitate π-π stacking interactions, making it relevant in various applications, including organic electronics and pharmaceuticals. The presence of the carbonyl group (ketone) at the 7-position enhances its reactivity and potential for forming hydrogen bonds, which can influence its solubility and interaction with biological targets. Additionally, the compound may exhibit fluorescence properties, making it useful in imaging and sensing applications. Its synthesis often involves multi-step organic reactions, and it may serve as a precursor or intermediate in the development of more complex molecules in medicinal chemistry. Overall, 7H-Naphtho[1,2,3-ij][2,7]naphthyridin-7-one is a compound of interest due to its structural complexity and potential utility in various scientific fields.
Formula:C15H8N2O
InChI:InChI=1S/C15H8N2O/c18-15-11-4-2-1-3-10(11)13-12-9(5-7-16-13)6-8-17-14(12)15/h1-8H
InChI key:InChIKey=BWQKHOMAOVUASZ-UHFFFAOYSA-N
SMILES:O=C1C=2C3=C(C=4C1=CC=CC4)N=CC=C3C=CN2
Synonyms:- Sampangin
- Sampangine
- 7H-Naphtho[1,2,3-ij][2,7]naphthyridin-7-one
- BC 1-21
- NSC 680736
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
Sampangine
CAS:Sampangine, an alkaloid, induces apoptosis by causing cell cycle arrest at the G0/G1 phase and inhibits the biosynthesis of heme.Formula:C15H8N2OColor and Shape:SolidMolecular weight:232.24

