CAS 116668-47-4

6-Amino-2-naphthoic acid

Description:

6-Amino-2-naphthoic acid is an organic compound characterized by its naphthalene structure, which features an amino group (-NH2) and a carboxylic acid group (-COOH) attached to the naphthalene ring. This compound is typically a white to off-white solid and is soluble in polar solvents such as water and alcohols, owing to the presence of the carboxylic acid group. It exhibits properties typical of amino acids, including the ability to participate in hydrogen bonding and form salts. The amino group allows for potential interactions in biological systems, making it of interest in pharmaceutical and biochemical applications. Additionally, 6-amino-2-naphthoic acid can be involved in various chemical reactions, such as acylation and amidation, which can be utilized in synthetic organic chemistry. Its unique structure also makes it a candidate for studies related to dye chemistry and materials science. As with many organic compounds, safety precautions should be taken when handling this substance, as it may pose health risks if ingested or inhaled.

Formula: C₁₁H₈NO₂

InChI: InChI=1/C11H9NO2/c12-10-4-3-7-5-9(11(13)14)2-1-8(7)6-10/h1-6H,12H2,(H,13,14)/p-1

SMILES: c1cc(cc2ccc(cc12)N)C(=O)[O-]

6-Amino-2-naphthoic Acid

CAS: 116668-47-4

Formula: C₁₁H₉NO₂

Purity: >97.0%(T)(HPLC)

Color and Shape: White to Orange to Green powder to crystal

Molecular weight: 187.20

Ref: 3B-A1938

2-Naphthalenecarboxylic acid, 6-amino-

CAS: 116668-47-4

Formula: C₁₁H₉NO₂

Purity: 95%

Color and Shape: Solid

Molecular weight: 187.1947

Ref: IN-DA000CYA

6-Amino-2-naphthoic acid

CAS: 116668-47-4

6-Amino-2-naphthoic acid

Formula: C₁₁H₉NO₂

Purity: 97%

Color and Shape: pale yellow solid

Molecular weight: 187.19g/mol

Ref: 54-OR51725

6-Amino-2-naphthoic acid

CAS: 116668-47-4

Ref: 7W-GM9334

6-Amino-2-naphthoic acid

CAS: 116668-47-4

Formula: C₁₁H₉NO₂

Purity: 90%

Color and Shape: Solid, Light brown powder

Molecular weight: 187.198

Ref: 10-F010652